C19H28N2O2S — CID 134031591
N-(3-butoxypropyl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide (PubChem CID 134031591) has the molecular formula C19H28N2O2S and a molecular weight of 348.51 g/mol. Its IUPAC name is N-(3-butoxypropyl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide.
| Compound Name | N-(3-butoxypropyl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 134031591 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | N-(3-butoxypropyl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide |
| SMILES | CCCCOCCCNC(=O)c1cc(C)n(Cc2cccs2)c1C |
| InChI | InChI=1S/C19H28N2O2S/c1-4-5-10-23-11-7-9-20-19(22)18-13-15(2)21(16(18)3)14-17-8-6-12-24-17/h6,8,12-13H,4-5,7,9-11,14H2,1-3H3,(H,20,22) |
| InChIKey | CJJKBSRVXDNPRM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|