C24H24ClN3OS2 — CID 5009040
N-butyl-5-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-2-methyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide (PubChem CID 5009040) has the molecular formula C24H24ClN3OS2 and a molecular weight of 470.06 g/mol. Its IUPAC name is N-butyl-5-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-2-methyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide.
| Compound Name | N-butyl-5-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-2-methyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 5009040 |
| Molecular Formula | C24H24ClN3OS2 |
| Molecular Weight | 470.06 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | N-butyl-5-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-2-methyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide |
| SMILES | CCCCNC(=O)c1cc(-c2csc(-c3ccccc3Cl)n2)n(Cc2cccs2)c1C |
| InChI | InChI=1S/C24H24ClN3OS2/c1-3-4-11-26-23(29)19-13-22(28(16(19)2)14-17-8-7-12-30-17)21-15-31-24(27-21)18-9-5-6-10-20(18)25/h5-10,12-13,15H,3-4,11,14H2,1-2H3,(H,26,29) |
| InChIKey | CCRSINQAANXQHP-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.06 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|