C26H31Cl2N3OS — CID 10074848
N-butyl-1-(cyclohexylmethyl)-5-[2-(2,4-dichlorophenyl)-1,3-thiazol-4-yl]-2-methylpyrrole-3-carboxamide (PubChem CID 10074848) has the molecular formula C26H31Cl2N3OS and a molecular weight of 504.53 g/mol. Its IUPAC name is N-butyl-1-(cyclohexylmethyl)-5-[2-(2,4-dichlorophenyl)-1,3-thiazol-4-yl]-2-methylpyrrole-3-carboxamide.
| Compound Name | N-butyl-1-(cyclohexylmethyl)-5-[2-(2,4-dichlorophenyl)-1,3-thiazol-4-yl]-2-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 10074848 |
| Molecular Formula | C26H31Cl2N3OS |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | N-butyl-1-(cyclohexylmethyl)-5-[2-(2,4-dichlorophenyl)-1,3-thiazol-4-yl]-2-methylpyrrole-3-carboxamide |
| SMILES | CCCCNC(=O)c1cc(-c2csc(-c3ccc(Cl)cc3Cl)n2)n(CC2CCCCC2)c1C |
| InChI | InChI=1S/C26H31Cl2N3OS/c1-3-4-12-29-25(32)21-14-24(31(17(21)2)15-18-8-6-5-7-9-18)23-16-33-26(30-23)20-11-10-19(27)13-22(20)28/h10-11,13-14,16,18H,3-9,12,15H2,1-2H3,(H,29,32) |
| InChIKey | YBKUOPIOSTYFBS-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|