C23H31FN2O — CID 10022081
N-butyl-1-(cyclohexylmethyl)-5-(4-fluorophenyl)-2-methylpyrrole-3-carboxamide (PubChem CID 10022081) has the molecular formula C23H31FN2O and a molecular weight of 370.51 g/mol. Its IUPAC name is N-butyl-1-(cyclohexylmethyl)-5-(4-fluorophenyl)-2-methylpyrrole-3-carboxamide.
| Compound Name | N-butyl-1-(cyclohexylmethyl)-5-(4-fluorophenyl)-2-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 10022081 |
| Molecular Formula | C23H31FN2O |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | N-butyl-1-(cyclohexylmethyl)-5-(4-fluorophenyl)-2-methylpyrrole-3-carboxamide |
| SMILES | CCCCNC(=O)c1cc(-c2ccc(F)cc2)n(CC2CCCCC2)c1C |
| InChI | InChI=1S/C23H31FN2O/c1-3-4-14-25-23(27)21-15-22(19-10-12-20(24)13-11-19)26(17(21)2)16-18-8-6-5-7-9-18/h10-13,15,18H,3-9,14,16H2,1-2H3,(H,25,27) |
| InChIKey | YEZRCIFRUAFVQO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|