C27H41N3O — CID 58998936
N-butyl-1-(cyclohexylmethyl)-5-[4-(diethylamino)phenyl]-2-methylpyrrole-3-carboxamide (PubChem CID 58998936) has the molecular formula C27H41N3O and a molecular weight of 423.65 g/mol. Its IUPAC name is N-butyl-1-(cyclohexylmethyl)-5-[4-(diethylamino)phenyl]-2-methylpyrrole-3-carboxamide.
| Compound Name | N-butyl-1-(cyclohexylmethyl)-5-[4-(diethylamino)phenyl]-2-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 58998936 |
| Molecular Formula | C27H41N3O |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 423.32 |
| IUPAC Name | N-butyl-1-(cyclohexylmethyl)-5-[4-(diethylamino)phenyl]-2-methylpyrrole-3-carboxamide |
| SMILES | CCCCNC(=O)c1cc(-c2ccc(N(CC)CC)cc2)n(CC2CCCCC2)c1C |
| InChI | InChI=1S/C27H41N3O/c1-5-8-18-28-27(31)25-19-26(23-14-16-24(17-15-23)29(6-2)7-3)30(21(25)4)20-22-12-10-9-11-13-22/h14-17,19,22H,5-13,18,20H2,1-4H3,(H,28,31) |
| InChIKey | LUJXWZLMZPQYAP-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|