C25H34F2N2O2 — CID 153011506
N-butyl-1-(cyclohexylmethyl)-5-[4-(2,2-difluoroethoxy)phenyl]-2-methylpyrrole-3-carboxamide (PubChem CID 153011506) has the molecular formula C25H34F2N2O2 and a molecular weight of 432.56 g/mol. Its IUPAC name is N-butyl-1-(cyclohexylmethyl)-5-[4-(2,2-difluoroethoxy)phenyl]-2-methylpyrrole-3-carboxamide.
| Compound Name | N-butyl-1-(cyclohexylmethyl)-5-[4-(2,2-difluoroethoxy)phenyl]-2-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 153011506 |
| Molecular Formula | C25H34F2N2O2 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | N-butyl-1-(cyclohexylmethyl)-5-[4-(2,2-difluoroethoxy)phenyl]-2-methylpyrrole-3-carboxamide |
| SMILES | CCCCNC(=O)c1cc(-c2ccc(OCC(F)F)cc2)n(CC2CCCCC2)c1C |
| InChI | InChI=1S/C25H34F2N2O2/c1-3-4-14-28-25(30)22-15-23(20-10-12-21(13-11-20)31-17-24(26)27)29(18(22)2)16-19-8-6-5-7-9-19/h10-13,15,19,24H,3-9,14,16-17H2,1-2H3,(H,28,30) |
| InChIKey | VADNNYIFEQNWOZ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|