C27H40ClN3O2 — CID 70985602
N'-butyl-5-(5-chloro-2-methoxy-4-methylphenyl)-1-(cyclohexylmethyl)-N'-ethyl-2-methylpyrrole-3-carbohydrazide (PubChem CID 70985602) has the molecular formula C27H40ClN3O2 and a molecular weight of 474.09 g/mol. Its IUPAC name is N'-butyl-5-(5-chloro-2-methoxy-4-methylphenyl)-1-(cyclohexylmethyl)-N'-ethyl-2-methylpyrrole-3-carbohydrazide.
| Compound Name | N'-butyl-5-(5-chloro-2-methoxy-4-methylphenyl)-1-(cyclohexylmethyl)-N'-ethyl-2-methylpyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 70985602 |
| Molecular Formula | C27H40ClN3O2 |
| Molecular Weight | 474.09 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | N'-butyl-5-(5-chloro-2-methoxy-4-methylphenyl)-1-(cyclohexylmethyl)-N'-ethyl-2-methylpyrrole-3-carbohydrazide |
| SMILES | CCCCN(CC)NC(=O)c1cc(-c2cc(Cl)c(C)cc2OC)n(CC2CCCCC2)c1C |
| InChI | InChI=1S/C27H40ClN3O2/c1-6-8-14-30(7-2)29-27(32)22-17-25(23-16-24(28)19(3)15-26(23)33-5)31(20(22)4)18-21-12-10-9-11-13-21/h15-17,21H,6-14,18H2,1-5H3,(H,29,32) |
| InChIKey | HWNLSBSVMOXMBH-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.09 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|