C25H31Cl2FN2O2 — CID 58998979
1-(cyclohexylmethyl)-5-(2,4-dichloro-5-fluorophenyl)-N-[(1S,2S)-2-hydroxycyclohexyl]-2-methylpyrrole-3-carboxamide (PubChem CID 58998979) has the molecular formula C25H31Cl2FN2O2 and a molecular weight of 481.44 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-5-(2,4-dichloro-5-fluorophenyl)-N-[(1S,2S)-2-hydroxycyclohexyl]-2-methylpyrrole-3-carboxamide.
| Compound Name | 1-(cyclohexylmethyl)-5-(2,4-dichloro-5-fluorophenyl)-N-[(1S,2S)-2-hydroxycyclohexyl]-2-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 58998979 |
| Molecular Formula | C25H31Cl2FN2O2 |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 1-(cyclohexylmethyl)-5-(2,4-dichloro-5-fluorophenyl)-N-[(1S,2S)-2-hydroxycyclohexyl]-2-methylpyrrole-3-carboxamide |
| SMILES | Cc1c(C(=O)N[C@H]2CCCC[C@@H]2O)cc(-c2cc(F)c(Cl)cc2Cl)n1CC1CCCCC1 |
| InChI | InChI=1S/C25H31Cl2FN2O2/c1-15-17(25(32)29-22-9-5-6-10-24(22)31)12-23(18-11-21(28)20(27)13-19(18)26)30(15)14-16-7-3-2-4-8-16/h11-13,16,22,24,31H,2-10,14H2,1H3,(H,29,32)/t22-,24-/m0/s1 |
| InChIKey | BXEIQPYULVFDQZ-UPVQGACJSA-N |
| XLogP | 6.52 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|