C24H29F3N2O4 — CID 11612423
N-(2-hydroxycyclohexyl)-2-methyl-1-[[(2R)-oxolan-2-yl]methyl]-5-[2-(trifluoromethoxy)phenyl]pyrrole-3-carboxamide (PubChem CID 11612423) has the molecular formula C24H29F3N2O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is N-(2-hydroxycyclohexyl)-2-methyl-1-[[(2R)-oxolan-2-yl]methyl]-5-[2-(trifluoromethoxy)phenyl]pyrrole-3-carboxamide.
| Compound Name | N-(2-hydroxycyclohexyl)-2-methyl-1-[[(2R)-oxolan-2-yl]methyl]-5-[2-(trifluoromethoxy)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 11612423 |
| Molecular Formula | C24H29F3N2O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | N-(2-hydroxycyclohexyl)-2-methyl-1-[[(2R)-oxolan-2-yl]methyl]-5-[2-(trifluoromethoxy)phenyl]pyrrole-3-carboxamide |
| SMILES | Cc1c(C(=O)NC2CCCCC2O)cc(-c2ccccc2OC(F)(F)F)n1C[C@H]1CCCO1 |
| InChI | InChI=1S/C24H29F3N2O4/c1-15-18(23(31)28-19-9-3-4-10-21(19)30)13-20(29(15)14-16-7-6-12-32-16)17-8-2-5-11-22(17)33-24(25,26)27/h2,5,8,11,13,16,19,21,30H,3-4,6-7,9-10,12,14H2,1H3,(H,28,31)/t16-,19?,21?/m1/s1 |
| InChIKey | PERQNEWOSCFHIP-YLZJTPGZSA-N |
| XLogP | 4.57 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |