C25H28N2O6 — CID 40951088
[2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 40951088) has the molecular formula C25H28N2O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | [2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 40951088 |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | [2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | Cc1cc(C(=O)COC(=O)CCCN2C(=O)c3ccccc3C2=O)c(C)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C25H28N2O6/c1-16-13-21(17(2)27(16)14-18-7-6-12-32-18)22(28)15-33-23(29)10-5-11-26-24(30)19-8-3-4-9-20(19)25(26)31/h3-4,8-9,13,18H,5-7,10-12,14-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | RZFDZGRHGJIQAA-SFHVURJKSA-N |
| XLogP | 3.09 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|