C25H24N2O4 — CID 40620857
2-[2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 40620857) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-[2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 40620857 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 2-[2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1cc(C(=O)CN2C(=O)c3cccc4cccc(c34)C2=O)c(C)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C25H24N2O4/c1-15-12-21(16(2)26(15)13-18-8-5-11-31-18)22(28)14-27-24(29)19-9-3-6-17-7-4-10-20(23(17)19)25(27)30/h3-4,6-7,9-10,12,18H,5,8,11,13-14H2,1-2H3/t18-/m0/s1 |
| InChIKey | WKFZFLJSCVOSBQ-SFHVURJKSA-N |
| XLogP | 3.92 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|