C13H14F3NO3 — CID 97333881
N-[(2S,3R)-2-methyloxolan-3-yl]-2-(trifluoromethoxy)benzamide (PubChem CID 97333881) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is N-[(2S,3R)-2-methyloxolan-3-yl]-2-(trifluoromethoxy)benzamide.
| Compound Name | N-[(2S,3R)-2-methyloxolan-3-yl]-2-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 97333881 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-[(2S,3R)-2-methyloxolan-3-yl]-2-(trifluoromethoxy)benzamide |
| SMILES | C[C@@H]1OCC[C@H]1NC(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H14F3NO3/c1-8-10(6-7-19-8)17-12(18)9-4-2-3-5-11(9)20-13(14,15)16/h2-5,8,10H,6-7H2,1H3,(H,17,18)/t8-,10+/m0/s1 |
| InChIKey | UMJHYYRQEARPDH-WCBMZHEXSA-N |
| XLogP | 2.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |