C17H20F4N2O3 — CID 91798052
N-[(1R,5R,6S,7R)-7-(dimethylamino)-2-oxabicyclo[3.2.0]heptan-6-yl]-2-(1,1,2,2-tetrafluoroethoxy)benzamide (PubChem CID 91798052) has the molecular formula C17H20F4N2O3 and a molecular weight of 376.35 g/mol. Its IUPAC name is N-[(1R,5R,6S,7R)-7-(dimethylamino)-2-oxabicyclo[3.2.0]heptan-6-yl]-2-(1,1,2,2-tetrafluoroethoxy)benzamide.
| Compound Name | N-[(1R,5R,6S,7R)-7-(dimethylamino)-2-oxabicyclo[3.2.0]heptan-6-yl]-2-(1,1,2,2-tetrafluoroethoxy)benzamide |
|---|---|
| PubChem CID | 91798052 |
| Molecular Formula | C17H20F4N2O3 |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-[(1R,5R,6S,7R)-7-(dimethylamino)-2-oxabicyclo[3.2.0]heptan-6-yl]-2-(1,1,2,2-tetrafluoroethoxy)benzamide |
| SMILES | CN(C)[C@@H]1[C@@H](NC(=O)c2ccccc2OC(F)(F)C(F)F)[C@H]2CCO[C@H]21 |
| InChI | InChI=1S/C17H20F4N2O3/c1-23(2)13-12(10-7-8-25-14(10)13)22-15(24)9-5-3-4-6-11(9)26-17(20,21)16(18)19/h3-6,10,12-14,16H,7-8H2,1-2H3,(H,22,24)/t10-,12+,13-,14-/m1/s1 |
| InChIKey | QSBYNKCRDWWJTQ-YXCITZCRSA-N |
| XLogP | 2.37 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|