C15H17F4NO4 — CID 156609682
N-(4-methoxyoxan-3-yl)-2-(1,1,2,2-tetrafluoroethoxy)benzamide (PubChem CID 156609682) has the molecular formula C15H17F4NO4 and a molecular weight of 351.30 g/mol. Its IUPAC name is N-(4-methoxyoxan-3-yl)-2-(1,1,2,2-tetrafluoroethoxy)benzamide.
| Compound Name | N-(4-methoxyoxan-3-yl)-2-(1,1,2,2-tetrafluoroethoxy)benzamide |
|---|---|
| PubChem CID | 156609682 |
| Molecular Formula | C15H17F4NO4 |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-(4-methoxyoxan-3-yl)-2-(1,1,2,2-tetrafluoroethoxy)benzamide |
| SMILES | COC1CCOCC1NC(=O)c1ccccc1OC(F)(F)C(F)F |
| InChI | InChI=1S/C15H17F4NO4/c1-22-12-6-7-23-8-10(12)20-13(21)9-4-2-3-5-11(9)24-15(18,19)14(16)17/h2-5,10,12,14H,6-8H2,1H3,(H,20,21) |
| InChIKey | SYZQFHJAEVXHQK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|