C18H21F4NO3 — CID 157012131
N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-2-(1,1,2,2-tetrafluoroethoxy)benzamide (PubChem CID 157012131) has the molecular formula C18H21F4NO3 and a molecular weight of 375.36 g/mol. Its IUPAC name is N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-2-(1,1,2,2-tetrafluoroethoxy)benzamide.
| Compound Name | N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-2-(1,1,2,2-tetrafluoroethoxy)benzamide |
|---|---|
| PubChem CID | 157012131 |
| Molecular Formula | C18H21F4NO3 |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-2-(1,1,2,2-tetrafluoroethoxy)benzamide |
| SMILES | CN(C(=O)c1ccccc1OC(F)(F)C(F)F)C1C[C@H]2CC(O)C[C@H]2C1 |
| InChI | InChI=1S/C18H21F4NO3/c1-23(12-6-10-8-13(24)9-11(10)7-12)16(25)14-4-2-3-5-15(14)26-18(21,22)17(19)20/h2-5,10-13,17,24H,6-9H2,1H3/t10-,11+,12?,13? |
| InChIKey | QEMKJXRGYMDHGJ-MPEURRAXSA-N |
| XLogP | 3.54 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|