C18H16F5NO3 — CID 131943368
N-[(4-fluorophenyl)methyl]-N-(2-hydroxyethyl)-2-(1,1,2,2-tetrafluoroethoxy)benzamide (PubChem CID 131943368) has the molecular formula C18H16F5NO3 and a molecular weight of 389.32 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-(2-hydroxyethyl)-2-(1,1,2,2-tetrafluoroethoxy)benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-(2-hydroxyethyl)-2-(1,1,2,2-tetrafluoroethoxy)benzamide |
|---|---|
| PubChem CID | 131943368 |
| Molecular Formula | C18H16F5NO3 |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-(2-hydroxyethyl)-2-(1,1,2,2-tetrafluoroethoxy)benzamide |
| SMILES | O=C(c1ccccc1OC(F)(F)C(F)F)N(CCO)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H16F5NO3/c19-13-7-5-12(6-8-13)11-24(9-10-25)16(26)14-3-1-2-4-15(14)27-18(22,23)17(20)21/h1-8,17,25H,9-11H2 |
| InChIKey | GJFBKAQWRLCCEQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|