C25H27FN2O2 — CID 71214650
N-(3-aminopropyl)-N-[(4-fluorophenyl)methyl]-2-[(3-methylphenyl)methoxy]benzamide (PubChem CID 71214650) has the molecular formula C25H27FN2O2 and a molecular weight of 406.50 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-[(4-fluorophenyl)methyl]-2-[(3-methylphenyl)methoxy]benzamide.
| Compound Name | N-(3-aminopropyl)-N-[(4-fluorophenyl)methyl]-2-[(3-methylphenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 71214650 |
| Molecular Formula | C25H27FN2O2 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | N-(3-aminopropyl)-N-[(4-fluorophenyl)methyl]-2-[(3-methylphenyl)methoxy]benzamide |
| SMILES | Cc1cccc(COc2ccccc2C(=O)N(CCCN)Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C25H27FN2O2/c1-19-6-4-7-21(16-19)18-30-24-9-3-2-8-23(24)25(29)28(15-5-14-27)17-20-10-12-22(26)13-11-20/h2-4,6-13,16H,5,14-15,17-18,27H2,1H3 |
| InChIKey | UYDWOEAXXQUDRF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |