C24H24ClFN2O2 — CID 71214624
N-(3-aminopropyl)-N-[(3-chloro-4-fluorophenyl)methyl]-2-phenylmethoxybenzamide (PubChem CID 71214624) has the molecular formula C24H24ClFN2O2 and a molecular weight of 426.92 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-[(3-chloro-4-fluorophenyl)methyl]-2-phenylmethoxybenzamide.
| Compound Name | N-(3-aminopropyl)-N-[(3-chloro-4-fluorophenyl)methyl]-2-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 71214624 |
| Molecular Formula | C24H24ClFN2O2 |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-(3-aminopropyl)-N-[(3-chloro-4-fluorophenyl)methyl]-2-phenylmethoxybenzamide |
| SMILES | NCCCN(Cc1ccc(F)c(Cl)c1)C(=O)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H24ClFN2O2/c25-21-15-19(11-12-22(21)26)16-28(14-6-13-27)24(29)20-9-4-5-10-23(20)30-17-18-7-2-1-3-8-18/h1-5,7-12,15H,6,13-14,16-17,27H2 |
| InChIKey | QTZBDANORIAIAC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |