C24H23Cl3N2O2 — CID 71214509
N-(3-aminopropyl)-2-phenylmethoxy-N-[(2,3,6-trichlorophenyl)methyl]benzamide (PubChem CID 71214509) has the molecular formula C24H23Cl3N2O2 and a molecular weight of 477.82 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-phenylmethoxy-N-[(2,3,6-trichlorophenyl)methyl]benzamide.
| Compound Name | N-(3-aminopropyl)-2-phenylmethoxy-N-[(2,3,6-trichlorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 71214509 |
| Molecular Formula | C24H23Cl3N2O2 |
| Molecular Weight | 477.82 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | N-(3-aminopropyl)-2-phenylmethoxy-N-[(2,3,6-trichlorophenyl)methyl]benzamide |
| SMILES | NCCCN(Cc1c(Cl)ccc(Cl)c1Cl)C(=O)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H23Cl3N2O2/c25-20-11-12-21(26)23(27)19(20)15-29(14-6-13-28)24(30)18-9-4-5-10-22(18)31-16-17-7-2-1-3-8-17/h1-5,7-12H,6,13-16,28H2 |
| InChIKey | INFXHYFOGHKXKW-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.82 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|