C21H16Cl3NO2 — CID 23019865
2,3-dichloro-N-[(2-chloro-6-phenylmethoxyphenyl)methyl]benzamide (PubChem CID 23019865) has the molecular formula C21H16Cl3NO2 and a molecular weight of 420.72 g/mol. Its IUPAC name is 2,3-dichloro-N-[(2-chloro-6-phenylmethoxyphenyl)methyl]benzamide.
| Compound Name | 2,3-dichloro-N-[(2-chloro-6-phenylmethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 23019865 |
| Molecular Formula | C21H16Cl3NO2 |
| Molecular Weight | 420.72 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | 2,3-dichloro-N-[(2-chloro-6-phenylmethoxyphenyl)methyl]benzamide |
| SMILES | O=C(NCc1c(Cl)cccc1OCc1ccccc1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C21H16Cl3NO2/c22-17-9-5-11-19(27-13-14-6-2-1-3-7-14)16(17)12-25-21(26)15-8-4-10-18(23)20(15)24/h1-11H,12-13H2,(H,25,26) |
| InChIKey | NPKZOXMLWWPXQA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.72 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |