C22H19Cl2NO2 — CID 23019842
2,3-dichloro-N-[(5-methyl-2-phenylmethoxyphenyl)methyl]benzamide (PubChem CID 23019842) has the molecular formula C22H19Cl2NO2 and a molecular weight of 400.31 g/mol. Its IUPAC name is 2,3-dichloro-N-[(5-methyl-2-phenylmethoxyphenyl)methyl]benzamide.
| Compound Name | 2,3-dichloro-N-[(5-methyl-2-phenylmethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 23019842 |
| Molecular Formula | C22H19Cl2NO2 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 2,3-dichloro-N-[(5-methyl-2-phenylmethoxyphenyl)methyl]benzamide |
| SMILES | Cc1ccc(OCc2ccccc2)c(CNC(=O)c2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C22H19Cl2NO2/c1-15-10-11-20(27-14-16-6-3-2-4-7-16)17(12-15)13-25-22(26)18-8-5-9-19(23)21(18)24/h2-12H,13-14H2,1H3,(H,25,26) |
| InChIKey | NALMWYSEPASNTQ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |