C25H28ClN3O3 — CID 71214567
N-[(4-chlorophenyl)methyl]-4-ethoxy-N-(2-hydrazinylethyl)-2-phenylmethoxybenzamide (PubChem CID 71214567) has the molecular formula C25H28ClN3O3 and a molecular weight of 453.97 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-4-ethoxy-N-(2-hydrazinylethyl)-2-phenylmethoxybenzamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-4-ethoxy-N-(2-hydrazinylethyl)-2-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 71214567 |
| Molecular Formula | C25H28ClN3O3 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-4-ethoxy-N-(2-hydrazinylethyl)-2-phenylmethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N(CCNN)Cc2ccc(Cl)cc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C25H28ClN3O3/c1-2-31-22-12-13-23(24(16-22)32-18-20-6-4-3-5-7-20)25(30)29(15-14-28-27)17-19-8-10-21(26)11-9-19/h3-13,16,28H,2,14-15,17-18,27H2,1H3 |
| InChIKey | CJDQNYPXODBYPI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|