C26H27NO6 — CID 110076846
2-[2-[benzyl-[(4-ethoxyphenyl)methyl]amino]-2-oxoethoxy]-4-methoxybenzoic acid (PubChem CID 110076846) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is 2-[2-[benzyl-[(4-ethoxyphenyl)methyl]amino]-2-oxoethoxy]-4-methoxybenzoic acid.
| Compound Name | 2-[2-[benzyl-[(4-ethoxyphenyl)methyl]amino]-2-oxoethoxy]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 110076846 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 2-[2-[benzyl-[(4-ethoxyphenyl)methyl]amino]-2-oxoethoxy]-4-methoxybenzoic acid |
| SMILES | CCOc1ccc(CN(Cc2ccccc2)C(=O)COc2cc(OC)ccc2C(=O)O)cc1 |
| InChI | InChI=1S/C26H27NO6/c1-3-32-21-11-9-20(10-12-21)17-27(16-19-7-5-4-6-8-19)25(28)18-33-24-15-22(31-2)13-14-23(24)26(29)30/h4-15H,3,16-18H2,1-2H3,(H,29,30) |
| InChIKey | FGNFMRNSGHFIFH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |