C26H29NO4 — CID 4732976
N,N-dibenzyl-2-[4-(2-ethoxyethoxy)phenoxy]acetamide (PubChem CID 4732976) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is N,N-dibenzyl-2-[4-(2-ethoxyethoxy)phenoxy]acetamide.
| Compound Name | N,N-dibenzyl-2-[4-(2-ethoxyethoxy)phenoxy]acetamide |
|---|---|
| PubChem CID | 4732976 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | N,N-dibenzyl-2-[4-(2-ethoxyethoxy)phenoxy]acetamide |
| SMILES | CCOCCOc1ccc(OCC(=O)N(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C26H29NO4/c1-2-29-17-18-30-24-13-15-25(16-14-24)31-21-26(28)27(19-22-9-5-3-6-10-22)20-23-11-7-4-8-12-23/h3-16H,2,17-21H2,1H3 |
| InChIKey | AUXWNMFVZKSYJZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|