C20H23NO2 — CID 134706743
N-[(3aS,6aR)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methylnaphthalene-1-carboxamide (PubChem CID 134706743) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[(3aS,6aR)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methylnaphthalene-1-carboxamide.
| Compound Name | N-[(3aS,6aR)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methylnaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 134706743 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-[(3aS,6aR)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methylnaphthalene-1-carboxamide |
| SMILES | CN(C(=O)c1cccc2ccccc12)C1C[C@H]2CC(O)C[C@H]2C1 |
| InChI | InChI=1S/C20H23NO2/c1-21(16-9-14-11-17(22)12-15(14)10-16)20(23)19-8-4-6-13-5-2-3-7-18(13)19/h2-8,14-17,22H,9-12H2,1H3/t14-,15+,16?,17? |
| InChIKey | ZWLHHPKVAHWICX-RYTJFDOTSA-N |
| XLogP | 3.46 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |