C20H26N2OS — CID 134705782
N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-1-benzothiophene-3-carboxamide (PubChem CID 134705782) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 134705782 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-1-benzothiophene-3-carboxamide |
| SMILES | CN(C)C1C[C@@H]2CC(N(C)C(=O)c3csc4ccccc34)C[C@@H]2C1 |
| InChI | InChI=1S/C20H26N2OS/c1-21(2)15-8-13-10-16(11-14(13)9-15)22(3)20(23)18-12-24-19-7-5-4-6-17(18)19/h4-7,12-16H,8-11H2,1-3H3/t13-,14+,15?,16? |
| InChIKey | BDVUNWILSCBOMM-PJPHBNEVSA-N |
| XLogP | 4.09 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |