C17H23NO4S — CID 134712002
N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-3-methylsulfonylbenzamide (PubChem CID 134712002) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-3-methylsulfonylbenzamide.
| Compound Name | N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 134712002 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-3-methylsulfonylbenzamide |
| SMILES | CN(C(=O)c1cccc(S(C)(=O)=O)c1)C1C[C@H]2CC(O)C[C@H]2C1 |
| InChI | InChI=1S/C17H23NO4S/c1-18(14-6-12-8-15(19)9-13(12)7-14)17(20)11-4-3-5-16(10-11)23(2,21)22/h3-5,10,12-15,19H,6-9H2,1-2H3/t12-,13+,14?,15? |
| InChIKey | CDDDLXGPJILLTJ-DGKWVBSXSA-N |
| XLogP | 1.71 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |