C17H20N4O4 — CID 91790731
N-[(1R,5R,6S,7R)-7-(dimethylamino)-2-oxabicyclo[3.2.0]heptan-6-yl]-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide (PubChem CID 91790731) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is N-[(1R,5R,6S,7R)-7-(dimethylamino)-2-oxabicyclo[3.2.0]heptan-6-yl]-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide.
| Compound Name | N-[(1R,5R,6S,7R)-7-(dimethylamino)-2-oxabicyclo[3.2.0]heptan-6-yl]-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 91790731 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N-[(1R,5R,6S,7R)-7-(dimethylamino)-2-oxabicyclo[3.2.0]heptan-6-yl]-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
| SMILES | CN(C)[C@@H]1[C@@H](NC(=O)c2ccc3[nH]c(=O)c(=O)[nH]c3c2)[C@H]2CCO[C@H]21 |
| InChI | InChI=1S/C17H20N4O4/c1-21(2)13-12(9-5-6-25-14(9)13)20-15(22)8-3-4-10-11(7-8)19-17(24)16(23)18-10/h3-4,7,9,12-14H,5-6H2,1-2H3,(H,18,23)(H,19,24)(H,20,22)/t9-,12+,13-,14-/m1/s1 |
| InChIKey | YVXJFKXRTJMEAZ-GJQVQUKXSA-N |
| XLogP | -0.34 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|