C25H25Cl2N3O2S2 — CID 3820670
N-butyl-5-[2-[(3,5-dichlorophenoxy)methyl]-1,3-thiazol-4-yl]-2-methyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide (PubChem CID 3820670) has the molecular formula C25H25Cl2N3O2S2 and a molecular weight of 534.53 g/mol. Its IUPAC name is N-butyl-5-[2-[(3,5-dichlorophenoxy)methyl]-1,3-thiazol-4-yl]-2-methyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide.
| Compound Name | N-butyl-5-[2-[(3,5-dichlorophenoxy)methyl]-1,3-thiazol-4-yl]-2-methyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3820670 |
| Molecular Formula | C25H25Cl2N3O2S2 |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | N-butyl-5-[2-[(3,5-dichlorophenoxy)methyl]-1,3-thiazol-4-yl]-2-methyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide |
| SMILES | CCCCNC(=O)c1cc(-c2csc(COc3cc(Cl)cc(Cl)c3)n2)n(Cc2cccs2)c1C |
| InChI | InChI=1S/C25H25Cl2N3O2S2/c1-3-4-7-28-25(31)21-12-23(30(16(21)2)13-20-6-5-8-33-20)22-15-34-24(29-22)14-32-19-10-17(26)9-18(27)11-19/h5-6,8-12,15H,3-4,7,13-14H2,1-2H3,(H,28,31) |
| InChIKey | GQLJDVVHTDORCF-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|