C17H27N3O3S2 — CID 134033896
[4-(2-methylpropyl)piperazin-1-yl]-(3-pyrrolidin-1-ylsulfonylthiophen-2-yl)methanone (PubChem CID 134033896) has the molecular formula C17H27N3O3S2 and a molecular weight of 385.56 g/mol. Its IUPAC name is [4-(2-methylpropyl)piperazin-1-yl]-(3-pyrrolidin-1-ylsulfonylthiophen-2-yl)methanone.
| Compound Name | [4-(2-methylpropyl)piperazin-1-yl]-(3-pyrrolidin-1-ylsulfonylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 134033896 |
| Molecular Formula | C17H27N3O3S2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | [4-(2-methylpropyl)piperazin-1-yl]-(3-pyrrolidin-1-ylsulfonylthiophen-2-yl)methanone |
| SMILES | CC(C)CN1CCN(C(=O)c2sccc2S(=O)(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C17H27N3O3S2/c1-14(2)13-18-8-10-19(11-9-18)17(21)16-15(5-12-24-16)25(22,23)20-6-3-4-7-20/h5,12,14H,3-4,6-11,13H2,1-2H3 |
| InChIKey | DLPGGSZCVLMWPM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |