C20H19N3O3 — CID 134035566
N-[3-[(4-cyanophenyl)methylcarbamoyl]phenyl]oxolane-2-carboxamide (PubChem CID 134035566) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[3-[(4-cyanophenyl)methylcarbamoyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[(4-cyanophenyl)methylcarbamoyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 134035566 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-[3-[(4-cyanophenyl)methylcarbamoyl]phenyl]oxolane-2-carboxamide |
| SMILES | N#Cc1ccc(CNC(=O)c2cccc(NC(=O)C3CCCO3)c2)cc1 |
| InChI | InChI=1S/C20H19N3O3/c21-12-14-6-8-15(9-7-14)13-22-19(24)16-3-1-4-17(11-16)23-20(25)18-5-2-10-26-18/h1,3-4,6-9,11,18H,2,5,10,13H2,(H,22,24)(H,23,25) |
| InChIKey | KJTFOSTXRJFXTN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |