C24H29N3O4 — CID 32781324
(2S)-N-[3-[[4-(morpholin-4-ylmethyl)phenyl]methylcarbamoyl]phenyl]oxolane-2-carboxamide (PubChem CID 32781324) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is (2S)-N-[3-[[4-(morpholin-4-ylmethyl)phenyl]methylcarbamoyl]phenyl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[3-[[4-(morpholin-4-ylmethyl)phenyl]methylcarbamoyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 32781324 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | (2S)-N-[3-[[4-(morpholin-4-ylmethyl)phenyl]methylcarbamoyl]phenyl]oxolane-2-carboxamide |
| SMILES | O=C(NCc1ccc(CN2CCOCC2)cc1)c1cccc(NC(=O)[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C24H29N3O4/c28-23(20-3-1-4-21(15-20)26-24(29)22-5-2-12-31-22)25-16-18-6-8-19(9-7-18)17-27-10-13-30-14-11-27/h1,3-4,6-9,15,22H,2,5,10-14,16-17H2,(H,25,28)(H,26,29)/t22-/m0/s1 |
| InChIKey | WSEFFJLOBULEBD-QFIPXVFZSA-N |
| XLogP | 2.57 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |