C24H32N4O2 — CID 134035755
4-tert-butyl-N-[1-oxo-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]propan-2-yl]benzamide (PubChem CID 134035755) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-oxo-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]propan-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[1-oxo-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 134035755 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 4-tert-butyl-N-[1-oxo-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]propan-2-yl]benzamide |
| SMILES | CC(NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)N1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C24H32N4O2/c1-18(26-22(29)20-7-9-21(10-8-20)24(2,3)4)23(30)28-14-12-27(13-15-28)17-19-6-5-11-25-16-19/h5-11,16,18H,12-15,17H2,1-4H3,(H,26,29) |
| InChIKey | CACVUUVVSTZYIS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |