C20H23N5O2S — CID 134039826
N-[2-(1-benzylimidazol-2-yl)ethyl]-3-(carbamoylamino)-3-thiophen-2-ylpropanamide (PubChem CID 134039826) has the molecular formula C20H23N5O2S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[2-(1-benzylimidazol-2-yl)ethyl]-3-(carbamoylamino)-3-thiophen-2-ylpropanamide.
| Compound Name | N-[2-(1-benzylimidazol-2-yl)ethyl]-3-(carbamoylamino)-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 134039826 |
| Molecular Formula | C20H23N5O2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[2-(1-benzylimidazol-2-yl)ethyl]-3-(carbamoylamino)-3-thiophen-2-ylpropanamide |
| SMILES | NC(=O)NC(CC(=O)NCCc1nccn1Cc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C20H23N5O2S/c21-20(27)24-16(17-7-4-12-28-17)13-19(26)23-9-8-18-22-10-11-25(18)14-15-5-2-1-3-6-15/h1-7,10-12,16H,8-9,13-14H2,(H,23,26)(H3,21,24,27) |
| InChIKey | YXVNGSYZJFCVPN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |