About 5,6-dibromo-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methyl-1H-indole-3-carboxamide
5,6-dibromo-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methyl-1H-indole-3-carboxamide (PubChem CID 134040947) has the molecular formula C20H19Br2N3O2
and a molecular weight of 493.20 g/mol. Its IUPAC name is 5,6-dibromo-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methyl-1H-indole-3-carboxamide.
Molecular Properties
| Compound Name | 5,6-dibromo-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methyl-1H-indole-3-carboxamide |
| PubChem CID | 134040947 |
| Molecular Formula | C20H19Br2N3O2 |
| Molecular Weight | 493.20 g/mol |
| Exact Mass | 490.98 |
| IUPAC Name | 5,6-dibromo-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methyl-1H-indole-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)CN(C)C(=O)c2c[nH]c3cc(Br)c(Br)cc23)c1C |
| InChI | InChI=1S/C20H19Br2N3O2/c1-11-5-4-6-17(12(11)2)24-19(26)10-25(3)20(27)14-9-23-18-8-16(22)15(21)7-13(14)18/h4-9,23H,10H2,1-3H3,(H,24,26) |
| InChIKey | XVEGLCBRFKMDIB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.20 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dibromo-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methyl-1H-indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dibromo-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methyl-1H-indole-3-carboxamide?
The IUPAC name of 5,6-dibromo-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methyl-1H-indole-3-carboxamide (CID 134040947) is 5,6-dibromo-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methyl-1H-indole-3-carboxamide.
What is the SMILES notation for 5,6-dibromo-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methyl-1H-indole-3-carboxamide?
The canonical SMILES for 5,6-dibromo-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methyl-1H-indole-3-carboxamide is Cc1cccc(NC(=O)CN(C)C(=O)c2c[nH]c3cc(Br)c(Br)cc23)c1C.
What is the InChIKey of 5,6-dibromo-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methyl-1H-indole-3-carboxamide?
The InChIKey is XVEGLCBRFKMDIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19Br2N3O2/c1-11-5-4-6-17(12(11)2)24-19(26)10-25(3)20(27)14-9-23-18-8-16(22)15(21)7-13(14)18/h4-9,23H,10H2,1-3H3,(H,24,26).
What are the key properties of 5,6-dibromo-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methyl-1H-indole-3-carboxamide?
5,6-dibromo-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methyl-1H-indole-3-carboxamide has a molecular weight of 493.20 g/mol, XLogP of 5.02, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dibromo-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methyl-1H-indole-3-carboxamide is sourced from PubChem (CID 134040947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).