About N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-4-oxo-3-propan-2-ylphthalazine-1-carboxamide
N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-4-oxo-3-propan-2-ylphthalazine-1-carboxamide (PubChem CID 134041268) has the molecular formula C19H23N3O4S
and a molecular weight of 389.48 g/mol. Its IUPAC name is N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-4-oxo-3-propan-2-ylphthalazine-1-carboxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-4-oxo-3-propan-2-ylphthalazine-1-carboxamide |
| PubChem CID | 134041268 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-4-oxo-3-propan-2-ylphthalazine-1-carboxamide |
| SMILES | CC(C)n1nc(C(=O)N(C2CC2)C2CCS(=O)(=O)C2)c2ccccc2c1=O |
| InChI | InChI=1S/C19H23N3O4S/c1-12(2)22-18(23)16-6-4-3-5-15(16)17(20-22)19(24)21(13-7-8-13)14-9-10-27(25,26)11-14/h3-6,12-14H,7-11H2,1-2H3 |
| InChIKey | QYZTZNODSBSTDI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 89.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-4-oxo-3-propan-2-ylphthalazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-4-oxo-3-propan-2-ylphthalazine-1-carboxamide?
The IUPAC name of N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-4-oxo-3-propan-2-ylphthalazine-1-carboxamide (CID 134041268) is N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-4-oxo-3-propan-2-ylphthalazine-1-carboxamide.
What is the SMILES notation for N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-4-oxo-3-propan-2-ylphthalazine-1-carboxamide?
The canonical SMILES for N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-4-oxo-3-propan-2-ylphthalazine-1-carboxamide is CC(C)n1nc(C(=O)N(C2CC2)C2CCS(=O)(=O)C2)c2ccccc2c1=O.
What is the InChIKey of N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-4-oxo-3-propan-2-ylphthalazine-1-carboxamide?
The InChIKey is QYZTZNODSBSTDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O4S/c1-12(2)22-18(23)16-6-4-3-5-15(16)17(20-22)19(24)21(13-7-8-13)14-9-10-27(25,26)11-14/h3-6,12-14H,7-11H2,1-2H3.
What are the key properties of N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-4-oxo-3-propan-2-ylphthalazine-1-carboxamide?
N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-4-oxo-3-propan-2-ylphthalazine-1-carboxamide has a molecular weight of 389.48 g/mol, XLogP of 1.77, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-4-oxo-3-propan-2-ylphthalazine-1-carboxamide is sourced from PubChem (CID 134041268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).