C12H9NO2 — CID 13404229
3-(furan-2-yl)-5-methyl-1,2-benzoxazole (PubChem CID 13404229) has the molecular formula C12H9NO2 and a molecular weight of 199.21 g/mol. Its IUPAC name is 3-(furan-2-yl)-5-methyl-1,2-benzoxazole.
| Compound Name | 3-(furan-2-yl)-5-methyl-1,2-benzoxazole |
|---|---|
| PubChem CID | 13404229 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 3-(furan-2-yl)-5-methyl-1,2-benzoxazole |
| SMILES | Cc1ccc2onc(-c3ccco3)c2c1 |
| InChI | InChI=1S/C12H9NO2/c1-8-4-5-10-9(7-8)12(13-15-10)11-3-2-6-14-11/h2-7H,1H3 |
| InChIKey | UMTFKNFVVPOAGH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |