C20H30FN3O3 — CID 134043909
N-butan-2-yl-2-[4-[3-(3-fluoro-4-methoxyphenyl)propanoyl]piperazin-1-yl]acetamide (PubChem CID 134043909) has the molecular formula C20H30FN3O3 and a molecular weight of 379.48 g/mol. Its IUPAC name is N-butan-2-yl-2-[4-[3-(3-fluoro-4-methoxyphenyl)propanoyl]piperazin-1-yl]acetamide.
| Compound Name | N-butan-2-yl-2-[4-[3-(3-fluoro-4-methoxyphenyl)propanoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 134043909 |
| Molecular Formula | C20H30FN3O3 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | N-butan-2-yl-2-[4-[3-(3-fluoro-4-methoxyphenyl)propanoyl]piperazin-1-yl]acetamide |
| SMILES | CCC(C)NC(=O)CN1CCN(C(=O)CCc2ccc(OC)c(F)c2)CC1 |
| InChI | InChI=1S/C20H30FN3O3/c1-4-15(2)22-19(25)14-23-9-11-24(12-10-23)20(26)8-6-16-5-7-18(27-3)17(21)13-16/h5,7,13,15H,4,6,8-12,14H2,1-3H3,(H,22,25) |
| InChIKey | JTTCXYFVOUIHSX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |