C17H25N3O3 — CID 134047066
N,4-dimethyl-3-nitro-N-(1-propan-2-ylpiperidin-4-yl)benzamide (PubChem CID 134047066) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is N,4-dimethyl-3-nitro-N-(1-propan-2-ylpiperidin-4-yl)benzamide.
| Compound Name | N,4-dimethyl-3-nitro-N-(1-propan-2-ylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 134047066 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N,4-dimethyl-3-nitro-N-(1-propan-2-ylpiperidin-4-yl)benzamide |
| SMILES | Cc1ccc(C(=O)N(C)C2CCN(C(C)C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H25N3O3/c1-12(2)19-9-7-15(8-10-19)18(4)17(21)14-6-5-13(3)16(11-14)20(22)23/h5-6,11-12,15H,7-10H2,1-4H3 |
| InChIKey | ULAWQTJNPXTUNL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|