C23H24N2O2 — CID 134048419
3-(3,5-dimethylphenoxy)-N-[phenyl(pyridin-2-yl)methyl]propanamide (PubChem CID 134048419) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 3-(3,5-dimethylphenoxy)-N-[phenyl(pyridin-2-yl)methyl]propanamide.
| Compound Name | 3-(3,5-dimethylphenoxy)-N-[phenyl(pyridin-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 134048419 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 3-(3,5-dimethylphenoxy)-N-[phenyl(pyridin-2-yl)methyl]propanamide |
| SMILES | Cc1cc(C)cc(OCCC(=O)NC(c2ccccc2)c2ccccn2)c1 |
| InChI | InChI=1S/C23H24N2O2/c1-17-14-18(2)16-20(15-17)27-13-11-22(26)25-23(19-8-4-3-5-9-19)21-10-6-7-12-24-21/h3-10,12,14-16,23H,11,13H2,1-2H3,(H,25,26) |
| InChIKey | QMFDENWUKVJTQB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |