C24H24N2O2 — CID 51152072
4-(4-ethylphenyl)-4-oxo-N-[phenyl(pyridin-2-yl)methyl]butanamide (PubChem CID 51152072) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-(4-ethylphenyl)-4-oxo-N-[phenyl(pyridin-2-yl)methyl]butanamide.
| Compound Name | 4-(4-ethylphenyl)-4-oxo-N-[phenyl(pyridin-2-yl)methyl]butanamide |
|---|---|
| PubChem CID | 51152072 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 4-(4-ethylphenyl)-4-oxo-N-[phenyl(pyridin-2-yl)methyl]butanamide |
| SMILES | CCc1ccc(C(=O)CCC(=O)NC(c2ccccc2)c2ccccn2)cc1 |
| InChI | InChI=1S/C24H24N2O2/c1-2-18-11-13-19(14-12-18)22(27)15-16-23(28)26-24(20-8-4-3-5-9-20)21-10-6-7-17-25-21/h3-14,17,24H,2,15-16H2,1H3,(H,26,28) |
| InChIKey | ZJLLFBNSLPTIKI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |