C23H26N4O2 — CID 134048899
N-(5-carbamoyl-2-piperidin-1-ylphenyl)-4,6-dimethyl-1H-indole-2-carboxamide (PubChem CID 134048899) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is N-(5-carbamoyl-2-piperidin-1-ylphenyl)-4,6-dimethyl-1H-indole-2-carboxamide.
| Compound Name | N-(5-carbamoyl-2-piperidin-1-ylphenyl)-4,6-dimethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 134048899 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | N-(5-carbamoyl-2-piperidin-1-ylphenyl)-4,6-dimethyl-1H-indole-2-carboxamide |
| SMILES | Cc1cc(C)c2cc(C(=O)Nc3cc(C(N)=O)ccc3N3CCCCC3)[nH]c2c1 |
| InChI | InChI=1S/C23H26N4O2/c1-14-10-15(2)17-13-20(25-18(17)11-14)23(29)26-19-12-16(22(24)28)6-7-21(19)27-8-4-3-5-9-27/h6-7,10-13,25H,3-5,8-9H2,1-2H3,(H2,24,28)(H,26,29) |
| InChIKey | XQJKFSPAWNXAQV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |