C24H30N4O4 — CID 55552861
tert-butyl N-[3-[(5-carbamoyl-2-piperidin-1-ylphenyl)carbamoyl]phenyl]carbamate (PubChem CID 55552861) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is tert-butyl N-[3-[(5-carbamoyl-2-piperidin-1-ylphenyl)carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[(5-carbamoyl-2-piperidin-1-ylphenyl)carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 55552861 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | tert-butyl N-[3-[(5-carbamoyl-2-piperidin-1-ylphenyl)carbamoyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(C(=O)Nc2cc(C(N)=O)ccc2N2CCCCC2)c1 |
| InChI | InChI=1S/C24H30N4O4/c1-24(2,3)32-23(31)26-18-9-7-8-17(14-18)22(30)27-19-15-16(21(25)29)10-11-20(19)28-12-5-4-6-13-28/h7-11,14-15H,4-6,12-13H2,1-3H3,(H2,25,29)(H,26,31)(H,27,30) |
| InChIKey | XJCLFAIAURFZLQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |