C12H11N3O3S — CID 134050746
N'-(cyclopropanecarbonyl)-5-thiophen-2-yl-1,2-oxazole-3-carbohydrazide (PubChem CID 134050746) has the molecular formula C12H11N3O3S and a molecular weight of 277.30 g/mol. Its IUPAC name is N'-(cyclopropanecarbonyl)-5-thiophen-2-yl-1,2-oxazole-3-carbohydrazide.
| Compound Name | N'-(cyclopropanecarbonyl)-5-thiophen-2-yl-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 134050746 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | N'-(cyclopropanecarbonyl)-5-thiophen-2-yl-1,2-oxazole-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CC1)c1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C12H11N3O3S/c16-11(7-3-4-7)13-14-12(17)8-6-9(18-15-8)10-2-1-5-19-10/h1-2,5-7H,3-4H2,(H,13,16)(H,14,17) |
| InChIKey | BYUNFLSYAXVMKQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|