C26H21N3O3S — CID 134051470
N-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 134051470) has the molecular formula C26H21N3O3S and a molecular weight of 455.54 g/mol. Its IUPAC name is N-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 134051470 |
| Molecular Formula | C26H21N3O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | COc1ccc(C)cc1-c1csc(NC(=O)Cn2c3ccccc3c(=O)c3ccccc32)n1 |
| InChI | InChI=1S/C26H21N3O3S/c1-16-11-12-23(32-2)19(13-16)20-15-33-26(27-20)28-24(30)14-29-21-9-5-3-7-17(21)25(31)18-8-4-6-10-22(18)29/h3-13,15H,14H2,1-2H3,(H,27,28,30) |
| InChIKey | MDAFRZKBORJWKH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|