C19H17Cl2N3O2S — CID 24509607
2-(2,4-dichloro-6-methyl-3-pyridinyl)-N-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 24509607) has the molecular formula C19H17Cl2N3O2S and a molecular weight of 422.34 g/mol. Its IUPAC name is 2-(2,4-dichloro-6-methyl-3-pyridinyl)-N-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(2,4-dichloro-6-methyl-3-pyridinyl)-N-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 24509607 |
| Molecular Formula | C19H17Cl2N3O2S |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 2-(2,4-dichloro-6-methyl-3-pyridinyl)-N-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1ccc(C)cc1-c1csc(NC(=O)Cc2c(Cl)cc(C)nc2Cl)n1 |
| InChI | InChI=1S/C19H17Cl2N3O2S/c1-10-4-5-16(26-3)13(6-10)15-9-27-19(23-15)24-17(25)8-12-14(20)7-11(2)22-18(12)21/h4-7,9H,8H2,1-3H3,(H,23,24,25) |
| InChIKey | ZRNQUOQXEXBWAF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|