C19H13F5N2O3S — CID 24555291
N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 24555291) has the molecular formula C19H13F5N2O3S and a molecular weight of 444.38 g/mol. Its IUPAC name is N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 24555291 |
| Molecular Formula | C19H13F5N2O3S |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | COc1ccc(OC)c(-c2csc(NC(=O)Cc3c(F)c(F)c(F)c(F)c3F)n2)c1 |
| InChI | InChI=1S/C19H13F5N2O3S/c1-28-8-3-4-12(29-2)9(5-8)11-7-30-19(25-11)26-13(27)6-10-14(20)16(22)18(24)17(23)15(10)21/h3-5,7H,6H2,1-2H3,(H,25,26,27) |
| InChIKey | RGNXZWRTCCLUQU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|