C18H24N2O4S — CID 38961150
N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-methylpropoxy)propanamide (PubChem CID 38961150) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-methylpropoxy)propanamide.
| Compound Name | N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-methylpropoxy)propanamide |
|---|---|
| PubChem CID | 38961150 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-methylpropoxy)propanamide |
| SMILES | COc1ccc(OC)c(-c2csc(NC(=O)CCOCC(C)C)n2)c1 |
| InChI | InChI=1S/C18H24N2O4S/c1-12(2)10-24-8-7-17(21)20-18-19-15(11-25-18)14-9-13(22-3)5-6-16(14)23-4/h5-6,9,11-12H,7-8,10H2,1-4H3,(H,19,20,21) |
| InChIKey | WCFFWUUCPQQBTC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|