C19H24N2O3S — CID 8873226
3-cyclopentyl-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 8873226) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is 3-cyclopentyl-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-cyclopentyl-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 8873226 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 3-cyclopentyl-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | COc1ccc(OC)c(-c2csc(NC(=O)CCC3CCCC3)n2)c1 |
| InChI | InChI=1S/C19H24N2O3S/c1-23-14-8-9-17(24-2)15(11-14)16-12-25-19(20-16)21-18(22)10-7-13-5-3-4-6-13/h8-9,11-13H,3-7,10H2,1-2H3,(H,20,21,22) |
| InChIKey | JCUAHJMLCPOWGF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |