C23H20N4O2S — CID 134052232
2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-hydroxy-5-methylphenyl)acetamide (PubChem CID 134052232) has the molecular formula C23H20N4O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-hydroxy-5-methylphenyl)acetamide.
| Compound Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-hydroxy-5-methylphenyl)acetamide |
|---|---|
| PubChem CID | 134052232 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-hydroxy-5-methylphenyl)acetamide |
| SMILES | Cc1ccc(O)c(NC(=O)CSc2nnc(-c3ccccc3)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C23H20N4O2S/c1-16-12-13-20(28)19(14-16)24-21(29)15-30-23-26-25-22(17-8-4-2-5-9-17)27(23)18-10-6-3-7-11-18/h2-14,28H,15H2,1H3,(H,24,29) |
| InChIKey | USTHUWKWBPCVLF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|